![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 5_4 Analysis of BJT ..> | 2012-11-09 09:47 | 25K | |
| A Mathematical Descr..> | 2012-11-09 09:47 | 275K | |
| A Mathematical Descr..> | 2012-11-09 09:47 | 225K | |
| BJT Structure and Mo..> | 2012-11-09 09:47 | 300K | |
| BJT Structure and Mo..> | 2012-11-09 09:47 | 152K | |
| BJT Symbols and Conv..> | 2012-11-09 09:47 | 43K | |
| BJT Symbols and Conv..> | 2012-11-09 09:47 | 85K | |
| Example An Analysis ..> | 2012-11-09 09:47 | 68K | |
| Example An Analysis ..> | 2012-11-09 09:47 | 105K | |
| Example Another BJT ..> | 2012-11-09 09:47 | 64K | |
| Example Another BJT ..> | 2012-11-09 09:47 | 103K | |
| Example DC Analysis ..> | 2012-11-09 09:47 | 146K | |
| Example DC Analysis ..> | 2012-11-09 09:47 | 131K | |
| Hints for BJT Circui..> | 2012-11-09 09:47 | 40K | |
| Hints for BJT Circui..> | 2012-11-09 09:47 | 78K | |
| Steps for DC Analysi..> | 2012-11-09 09:47 | 177K | |
| Steps for DC Analysi..> | 2012-11-09 09:47 | 223K | |
| section 5_4 BJT Circ..> | 2012-11-09 09:47 | 26K | |
| section 5_4 BJT Circ..> | 2012-11-09 09:47 | 69K | |
| section 5_4 BJT Circ..> | 2012-11-09 09:47 | 495K | |